C9H16N4O2 — CID 61397774
6-(3-methylpentan-2-ylamino)-2H-1,2,4-triazine-3,5-dione (PubChem CID 61397774) has the molecular formula C9H16N4O2 and a molecular weight of 212.25 g/mol. Its IUPAC name is 6-(3-methylpentan-2-ylamino)-2H-1,2,4-triazine-3,5-dione.
| Compound Name | 6-(3-methylpentan-2-ylamino)-2H-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 61397774 |
| Molecular Formula | C9H16N4O2 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 6-(3-methylpentan-2-ylamino)-2H-1,2,4-triazine-3,5-dione |
| SMILES | CCC(C)C(C)Nc1n[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C9H16N4O2/c1-4-5(2)6(3)10-7-8(14)11-9(15)13-12-7/h5-6H,4H2,1-3H3,(H,10,12)(H2,11,13,14,15) |
| InChIKey | GKDKNOCWNCFXEP-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 90.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |