About 3-chloro-4-(5-methyl-1H-1,2,4-triazol-3-yl)aniline
3-chloro-4-(5-methyl-1H-1,2,4-triazol-3-yl)aniline (PubChem CID 61399009) has the molecular formula C9H9ClN4
and a molecular weight of 208.65 g/mol. Its IUPAC name is 3-chloro-4-(5-methyl-1H-1,2,4-triazol-3-yl)aniline.
Molecular Properties
| Compound Name | 3-chloro-4-(5-methyl-1H-1,2,4-triazol-3-yl)aniline |
| PubChem CID | 61399009 |
| Molecular Formula | C9H9ClN4 |
| Molecular Weight | 208.65 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | 3-chloro-4-(5-methyl-1H-1,2,4-triazol-3-yl)aniline |
| SMILES | Cc1nc(-c2ccc(N)cc2Cl)n[nH]1 |
| InChI | InChI=1S/C9H9ClN4/c1-5-12-9(14-13-5)7-3-2-6(11)4-8(7)10/h2-4H,11H2,1H3,(H,12,13,14) |
| InChIKey | RHQWCQAZOXBOJJ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.65 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-4-(5-methyl-1H-1,2,4-triazol-3-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-4-(5-methyl-1H-1,2,4-triazol-3-yl)aniline?
The IUPAC name of 3-chloro-4-(5-methyl-1H-1,2,4-triazol-3-yl)aniline (CID 61399009) is 3-chloro-4-(5-methyl-1H-1,2,4-triazol-3-yl)aniline.
What is the SMILES notation for 3-chloro-4-(5-methyl-1H-1,2,4-triazol-3-yl)aniline?
The canonical SMILES for 3-chloro-4-(5-methyl-1H-1,2,4-triazol-3-yl)aniline is Cc1nc(-c2ccc(N)cc2Cl)n[nH]1.
What is the InChIKey of 3-chloro-4-(5-methyl-1H-1,2,4-triazol-3-yl)aniline?
The InChIKey is RHQWCQAZOXBOJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9ClN4/c1-5-12-9(14-13-5)7-3-2-6(11)4-8(7)10/h2-4H,11H2,1H3,(H,12,13,14).
What are the key properties of 3-chloro-4-(5-methyl-1H-1,2,4-triazol-3-yl)aniline?
3-chloro-4-(5-methyl-1H-1,2,4-triazol-3-yl)aniline has a molecular weight of 208.65 g/mol, XLogP of 2.02, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-4-(5-methyl-1H-1,2,4-triazol-3-yl)aniline is sourced from PubChem (CID 61399009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).