About 4-(1,4-diazepan-1-yl)-4-oxobut-2-enoic acid
4-(1,4-diazepan-1-yl)-4-oxobut-2-enoic acid (PubChem CID 61405567) has the molecular formula C9H14N2O3
and a molecular weight of 198.22 g/mol. Its IUPAC name is 4-(1,4-diazepan-1-yl)-4-oxobut-2-enoic acid.
Molecular Properties
| Compound Name | 4-(1,4-diazepan-1-yl)-4-oxobut-2-enoic acid |
| PubChem CID | 61405567 |
| Molecular Formula | C9H14N2O3 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | 4-(1,4-diazepan-1-yl)-4-oxobut-2-enoic acid |
| SMILES | O=C(O)C=CC(=O)N1CCCNCC1 |
| InChI | InChI=1S/C9H14N2O3/c12-8(2-3-9(13)14)11-6-1-4-10-5-7-11/h2-3,10H,1,4-7H2,(H,13,14) |
| InChIKey | CZTPHALBDIGAIA-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(1,4-diazepan-1-yl)-4-oxobut-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,4-diazepan-1-yl)-4-oxobut-2-enoic acid?
The IUPAC name of 4-(1,4-diazepan-1-yl)-4-oxobut-2-enoic acid (CID 61405567) is 4-(1,4-diazepan-1-yl)-4-oxobut-2-enoic acid.
What is the SMILES notation for 4-(1,4-diazepan-1-yl)-4-oxobut-2-enoic acid?
The canonical SMILES for 4-(1,4-diazepan-1-yl)-4-oxobut-2-enoic acid is O=C(O)C=CC(=O)N1CCCNCC1.
What is the InChIKey of 4-(1,4-diazepan-1-yl)-4-oxobut-2-enoic acid?
The InChIKey is CZTPHALBDIGAIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O3/c12-8(2-3-9(13)14)11-6-1-4-10-5-7-11/h2-3,10H,1,4-7H2,(H,13,14).
What are the key properties of 4-(1,4-diazepan-1-yl)-4-oxobut-2-enoic acid?
4-(1,4-diazepan-1-yl)-4-oxobut-2-enoic acid has a molecular weight of 198.22 g/mol, XLogP of -0.55, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,4-diazepan-1-yl)-4-oxobut-2-enoic acid is sourced from PubChem (CID 61405567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).