C11H21N3O3 — CID 61405662
3-methyl-2-(piperazine-1-carbonylamino)pentanoic acid (PubChem CID 61405662) has the molecular formula C11H21N3O3 and a molecular weight of 243.31 g/mol. Its IUPAC name is 3-methyl-2-(piperazine-1-carbonylamino)pentanoic acid.
| Compound Name | 3-methyl-2-(piperazine-1-carbonylamino)pentanoic acid |
|---|---|
| PubChem CID | 61405662 |
| Molecular Formula | C11H21N3O3 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | 3-methyl-2-(piperazine-1-carbonylamino)pentanoic acid |
| SMILES | CCC(C)C(NC(=O)N1CCNCC1)C(=O)O |
| InChI | InChI=1S/C11H21N3O3/c1-3-8(2)9(10(15)16)13-11(17)14-6-4-12-5-7-14/h8-9,12H,3-7H2,1-2H3,(H,13,17)(H,15,16) |
| InChIKey | WMUXGWXVOQHMAB-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |