C13H16N2O4 — CID 61405929
2-(1-cyclopropylethylcarbamoylamino)-5-hydroxybenzoic acid (PubChem CID 61405929) has the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. Its IUPAC name is 2-(1-cyclopropylethylcarbamoylamino)-5-hydroxybenzoic acid.
| Compound Name | 2-(1-cyclopropylethylcarbamoylamino)-5-hydroxybenzoic acid |
|---|---|
| PubChem CID | 61405929 |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 2-(1-cyclopropylethylcarbamoylamino)-5-hydroxybenzoic acid |
| SMILES | CC(NC(=O)Nc1ccc(O)cc1C(=O)O)C1CC1 |
| InChI | InChI=1S/C13H16N2O4/c1-7(8-2-3-8)14-13(19)15-11-5-4-9(16)6-10(11)12(17)18/h4-8,16H,2-3H2,1H3,(H,17,18)(H2,14,15,19) |
| InChIKey | PWTNIEPSGROVSR-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|