C13H16FNO2 — CID 61407533
5-fluoro-2-[2-(hydroxymethyl)piperidin-1-yl]benzaldehyde (PubChem CID 61407533) has the molecular formula C13H16FNO2 and a molecular weight of 237.27 g/mol. Its IUPAC name is 5-fluoro-2-[2-(hydroxymethyl)piperidin-1-yl]benzaldehyde.
| Compound Name | 5-fluoro-2-[2-(hydroxymethyl)piperidin-1-yl]benzaldehyde |
|---|---|
| PubChem CID | 61407533 |
| Molecular Formula | C13H16FNO2 |
| Molecular Weight | 237.27 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 5-fluoro-2-[2-(hydroxymethyl)piperidin-1-yl]benzaldehyde |
| SMILES | O=Cc1cc(F)ccc1N1CCCCC1CO |
| InChI | InChI=1S/C13H16FNO2/c14-11-4-5-13(10(7-11)8-16)15-6-2-1-3-12(15)9-17/h4-5,7-8,12,17H,1-3,6,9H2 |
| InChIKey | JOOSBBRODWZJAH-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.27 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|