C12H23N3O4 — CID 61408514
3-hydroxy-2-[[3-(methylaminomethyl)piperidine-1-carbonyl]amino]butanoic acid (PubChem CID 61408514) has the molecular formula C12H23N3O4 and a molecular weight of 273.33 g/mol. Its IUPAC name is 3-hydroxy-2-[[3-(methylaminomethyl)piperidine-1-carbonyl]amino]butanoic acid.
| Compound Name | 3-hydroxy-2-[[3-(methylaminomethyl)piperidine-1-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 61408514 |
| Molecular Formula | C12H23N3O4 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | 3-hydroxy-2-[[3-(methylaminomethyl)piperidine-1-carbonyl]amino]butanoic acid |
| SMILES | CNCC1CCCN(C(=O)NC(C(=O)O)C(C)O)C1 |
| InChI | InChI=1S/C12H23N3O4/c1-8(16)10(11(17)18)14-12(19)15-5-3-4-9(7-15)6-13-2/h8-10,13,16H,3-7H2,1-2H3,(H,14,19)(H,17,18) |
| InChIKey | YNFRMXLRHPIYLT-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |