C10H13FN2O — CID 61409466
[1-(5-fluoro-2-pyridinyl)pyrrolidin-2-yl]methanol (PubChem CID 61409466) has the molecular formula C10H13FN2O and a molecular weight of 196.22 g/mol. Its IUPAC name is [1-(5-fluoro-2-pyridinyl)pyrrolidin-2-yl]methanol.
| Compound Name | [1-(5-fluoro-2-pyridinyl)pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 61409466 |
| Molecular Formula | C10H13FN2O |
| Molecular Weight | 196.22 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | [1-(5-fluoro-2-pyridinyl)pyrrolidin-2-yl]methanol |
| SMILES | OCC1CCCN1c1ccc(F)cn1 |
| InChI | InChI=1S/C10H13FN2O/c11-8-3-4-10(12-6-8)13-5-1-2-9(13)7-14/h3-4,6,9,14H,1-2,5,7H2 |
| InChIKey | DCGUYSJULFMALT-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.22 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |