C11H16N4O5S — CID 61409771
[1-(4-hydrazinyl-3-nitrophenyl)sulfonylpyrrolidin-2-yl]methanol (PubChem CID 61409771) has the molecular formula C11H16N4O5S and a molecular weight of 316.34 g/mol. Its IUPAC name is [1-(4-hydrazinyl-3-nitrophenyl)sulfonylpyrrolidin-2-yl]methanol.
| Compound Name | [1-(4-hydrazinyl-3-nitrophenyl)sulfonylpyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 61409771 |
| Molecular Formula | C11H16N4O5S |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | [1-(4-hydrazinyl-3-nitrophenyl)sulfonylpyrrolidin-2-yl]methanol |
| SMILES | NNc1ccc(S(=O)(=O)N2CCCC2CO)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H16N4O5S/c12-13-10-4-3-9(6-11(10)15(17)18)21(19,20)14-5-1-2-8(14)7-16/h3-4,6,8,13,16H,1-2,5,7,12H2 |
| InChIKey | ZNIGCLIAZMFGEJ-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 138.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|