C10H15N3O — CID 61411496
3-amino-1-methyl-1-[(3-methylphenyl)methyl]urea (PubChem CID 61411496) has the molecular formula C10H15N3O and a molecular weight of 193.25 g/mol. Its IUPAC name is 3-amino-1-methyl-1-[(3-methylphenyl)methyl]urea.
| Compound Name | 3-amino-1-methyl-1-[(3-methylphenyl)methyl]urea |
|---|---|
| PubChem CID | 61411496 |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | 3-amino-1-methyl-1-[(3-methylphenyl)methyl]urea |
| SMILES | Cc1cccc(CN(C)C(=O)NN)c1 |
| InChI | InChI=1S/C10H15N3O/c1-8-4-3-5-9(6-8)7-13(2)10(14)12-11/h3-6H,7,11H2,1-2H3,(H,12,14) |
| InChIKey | YATVBSMLXLDLPQ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|