2-(2-methoxyethyl)-1,3-thiazole-5-carboxylic acid

C7H9NO3S — CID 61412548

IUPAC2-(2-methoxyethyl)-1,3-thiazole-5-carboxylic acid
SMILESCOCCc1ncc(C(=O)O)s1
InChIInChI=1S/C7H9NO3S/c1-11-3-2-6-8-4-5(12-6)7(9)10/h4H,2-3H2,1H3,(H,9,10)
InChIKeyGMBMTNPYLPQHRM-UHFFFAOYSA-N
MW187.22 g/mol
LogP1.03
Rot. Bonds4

About 2-(2-methoxyethyl)-1,3-thiazole-5-carboxylic acid

2-(2-methoxyethyl)-1,3-thiazole-5-carboxylic acid (PubChem CID 61412548) has the molecular formula C7H9NO3S and a molecular weight of 187.22 g/mol. Its IUPAC name is 2-(2-methoxyethyl)-1,3-thiazole-5-carboxylic acid.

Molecular Properties

Compound Name2-(2-methoxyethyl)-1,3-thiazole-5-carboxylic acid
PubChem CID61412548
Molecular FormulaC7H9NO3S
Molecular Weight187.22 g/mol
Exact Mass187.03
IUPAC Name2-(2-methoxyethyl)-1,3-thiazole-5-carboxylic acid
SMILESCOCCc1ncc(C(=O)O)s1
InChIInChI=1S/C7H9NO3S/c1-11-3-2-6-8-4-5(12-6)7(9)10/h4H,2-3H2,1H3,(H,9,10)
InChIKeyGMBMTNPYLPQHRM-UHFFFAOYSA-N
XLogP1.03
TPSA59.42 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500187.22
LogP ≤ 51.03
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-(2-methoxyethyl)-1,3-thiazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2-methoxyethyl)-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 2-(2-methoxyethyl)-1,3-thiazole-5-carboxylic acid (CID 61412548) is 2-(2-methoxyethyl)-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 2-(2-methoxyethyl)-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 2-(2-methoxyethyl)-1,3-thiazole-5-carboxylic acid is COCCc1ncc(C(=O)O)s1.
What is the InChIKey of 2-(2-methoxyethyl)-1,3-thiazole-5-carboxylic acid?
The InChIKey is GMBMTNPYLPQHRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO3S/c1-11-3-2-6-8-4-5(12-6)7(9)10/h4H,2-3H2,1H3,(H,9,10).
What are the key properties of 2-(2-methoxyethyl)-1,3-thiazole-5-carboxylic acid?
2-(2-methoxyethyl)-1,3-thiazole-5-carboxylic acid has a molecular weight of 187.22 g/mol, XLogP of 1.03, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methoxyethyl)-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 61412548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).