C12H14FN3O2S — CID 61412898
N-(2-amino-2-sulfanylideneethyl)-N'-[(2-fluorophenyl)methyl]-N'-methyloxamide (PubChem CID 61412898) has the molecular formula C12H14FN3O2S and a molecular weight of 283.33 g/mol. Its IUPAC name is N-(2-amino-2-sulfanylideneethyl)-N'-[(2-fluorophenyl)methyl]-N'-methyloxamide.
| Compound Name | N-(2-amino-2-sulfanylideneethyl)-N'-[(2-fluorophenyl)methyl]-N'-methyloxamide |
|---|---|
| PubChem CID | 61412898 |
| Molecular Formula | C12H14FN3O2S |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | N-(2-amino-2-sulfanylideneethyl)-N'-[(2-fluorophenyl)methyl]-N'-methyloxamide |
| SMILES | CN(Cc1ccccc1F)C(=O)C(=O)NCC(N)=S |
| InChI | InChI=1S/C12H14FN3O2S/c1-16(7-8-4-2-3-5-9(8)13)12(18)11(17)15-6-10(14)19/h2-5H,6-7H2,1H3,(H2,14,19)(H,15,17) |
| InChIKey | KNSRFJASRSVDQF-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|