C10H10N4O3S — CID 614132
1-[5-amino-2-(3-nitrophenyl)-2H-1,3,4-thiadiazol-3-yl]ethanone (PubChem CID 614132) has the molecular formula C10H10N4O3S and a molecular weight of 266.28 g/mol. Its IUPAC name is 1-[5-amino-2-(3-nitrophenyl)-2H-1,3,4-thiadiazol-3-yl]ethanone.
| Compound Name | 1-[5-amino-2-(3-nitrophenyl)-2H-1,3,4-thiadiazol-3-yl]ethanone |
|---|---|
| PubChem CID | 614132 |
| Molecular Formula | C10H10N4O3S |
| Molecular Weight | 266.28 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | 1-[5-amino-2-(3-nitrophenyl)-2H-1,3,4-thiadiazol-3-yl]ethanone |
| SMILES | CC(=O)N1N=C(N)SC1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H10N4O3S/c1-6(15)13-9(18-10(11)12-13)7-3-2-4-8(5-7)14(16)17/h2-5,9H,1H3,(H2,11,12) |
| InChIKey | UMBZQBWEMSYJEI-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 101.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.28 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|