C14H24S — CID 614151
9-methyl-2,3,4,4a,5,6,7,8,8a,9,9a,10a-dodecahydro-1H-thioxanthene (PubChem CID 614151) has the molecular formula C14H24S and a molecular weight of 224.41 g/mol. Its IUPAC name is 9-methyl-2,3,4,4a,5,6,7,8,8a,9,9a,10a-dodecahydro-1H-thioxanthene.
| Compound Name | 9-methyl-2,3,4,4a,5,6,7,8,8a,9,9a,10a-dodecahydro-1H-thioxanthene |
|---|---|
| PubChem CID | 614151 |
| Molecular Formula | C14H24S |
| Molecular Weight | 224.41 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | 9-methyl-2,3,4,4a,5,6,7,8,8a,9,9a,10a-dodecahydro-1H-thioxanthene |
| SMILES | CC1C2CCCCC2SC2CCCCC21 |
| InChI | InChI=1S/C14H24S/c1-10-11-6-2-4-8-13(11)15-14-9-5-3-7-12(10)14/h10-14H,2-9H2,1H3 |
| InChIKey | FGGXDTZWUCNTPS-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.41 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |