C14H14BrN3S — CID 61416167
2-[(3-bromophenyl)methyl-methylamino]pyridine-3-carbothioamide (PubChem CID 61416167) has the molecular formula C14H14BrN3S and a molecular weight of 336.26 g/mol. Its IUPAC name is 2-[(3-bromophenyl)methyl-methylamino]pyridine-3-carbothioamide.
| Compound Name | 2-[(3-bromophenyl)methyl-methylamino]pyridine-3-carbothioamide |
|---|---|
| PubChem CID | 61416167 |
| Molecular Formula | C14H14BrN3S |
| Molecular Weight | 336.26 g/mol |
| Exact Mass | 335.01 |
| IUPAC Name | 2-[(3-bromophenyl)methyl-methylamino]pyridine-3-carbothioamide |
| SMILES | CN(Cc1cccc(Br)c1)c1ncccc1C(N)=S |
| InChI | InChI=1S/C14H14BrN3S/c1-18(9-10-4-2-5-11(15)8-10)14-12(13(16)19)6-3-7-17-14/h2-8H,9H2,1H3,(H2,16,19) |
| InChIKey | OGYUOTWLGBJJQM-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.26 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|