C15H16BrClN2O — CID 61416672
N-[(2-bromophenyl)methyl]-4-chloro-1-ethyl-N-methylpyrrole-2-carboxamide (PubChem CID 61416672) has the molecular formula C15H16BrClN2O and a molecular weight of 355.66 g/mol. Its IUPAC name is N-[(2-bromophenyl)methyl]-4-chloro-1-ethyl-N-methylpyrrole-2-carboxamide.
| Compound Name | N-[(2-bromophenyl)methyl]-4-chloro-1-ethyl-N-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 61416672 |
| Molecular Formula | C15H16BrClN2O |
| Molecular Weight | 355.66 g/mol |
| Exact Mass | 354.01 |
| IUPAC Name | N-[(2-bromophenyl)methyl]-4-chloro-1-ethyl-N-methylpyrrole-2-carboxamide |
| SMILES | CCn1cc(Cl)cc1C(=O)N(C)Cc1ccccc1Br |
| InChI | InChI=1S/C15H16BrClN2O/c1-3-19-10-12(17)8-14(19)15(20)18(2)9-11-6-4-5-7-13(11)16/h4-8,10H,3,9H2,1-2H3 |
| InChIKey | ZMZLDOQOPGKDMZ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.66 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |