C15H15ClN2S — CID 61417210
2-[(2-chlorophenyl)methyl-methylamino]benzenecarbothioamide (PubChem CID 61417210) has the molecular formula C15H15ClN2S and a molecular weight of 290.82 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methyl-methylamino]benzenecarbothioamide.
| Compound Name | 2-[(2-chlorophenyl)methyl-methylamino]benzenecarbothioamide |
|---|---|
| PubChem CID | 61417210 |
| Molecular Formula | C15H15ClN2S |
| Molecular Weight | 290.82 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | 2-[(2-chlorophenyl)methyl-methylamino]benzenecarbothioamide |
| SMILES | CN(Cc1ccccc1Cl)c1ccccc1C(N)=S |
| InChI | InChI=1S/C15H15ClN2S/c1-18(10-11-6-2-4-8-13(11)16)14-9-5-3-7-12(14)15(17)19/h2-9H,10H2,1H3,(H2,17,19) |
| InChIKey | UKRJUEVOTWFAGQ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.82 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|