C14H20N4OS — CID 61418124
3-[(2-methoxyphenyl)methyl-methylamino]-4-propyl-1H-1,2,4-triazole-5-thione (PubChem CID 61418124) has the molecular formula C14H20N4OS and a molecular weight of 292.41 g/mol. Its IUPAC name is 3-[(2-methoxyphenyl)methyl-methylamino]-4-propyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-[(2-methoxyphenyl)methyl-methylamino]-4-propyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 61418124 |
| Molecular Formula | C14H20N4OS |
| Molecular Weight | 292.41 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 3-[(2-methoxyphenyl)methyl-methylamino]-4-propyl-1H-1,2,4-triazole-5-thione |
| SMILES | CCCn1c(N(C)Cc2ccccc2OC)n[nH]c1=S |
| InChI | InChI=1S/C14H20N4OS/c1-4-9-18-13(15-16-14(18)20)17(2)10-11-7-5-6-8-12(11)19-3/h5-8H,4,9-10H2,1-3H3,(H,16,20) |
| InChIKey | OJZYOXUGFGLFFK-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 46.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.41 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|