C15H23N3OS — CID 61418422
N-(5-amino-2-methylphenyl)-3-(1,4-thiazepan-4-yl)propanamide (PubChem CID 61418422) has the molecular formula C15H23N3OS and a molecular weight of 293.44 g/mol. Its IUPAC name is N-(5-amino-2-methylphenyl)-3-(1,4-thiazepan-4-yl)propanamide.
| Compound Name | N-(5-amino-2-methylphenyl)-3-(1,4-thiazepan-4-yl)propanamide |
|---|---|
| PubChem CID | 61418422 |
| Molecular Formula | C15H23N3OS |
| Molecular Weight | 293.44 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | N-(5-amino-2-methylphenyl)-3-(1,4-thiazepan-4-yl)propanamide |
| SMILES | Cc1ccc(N)cc1NC(=O)CCN1CCCSCC1 |
| InChI | InChI=1S/C15H23N3OS/c1-12-3-4-13(16)11-14(12)17-15(19)5-7-18-6-2-9-20-10-8-18/h3-4,11H,2,5-10,16H2,1H3,(H,17,19) |
| InChIKey | KXZMAINSWSTHLG-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.44 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|