C14H23ClN2O2 — CID 61418447
3-chloro-N,N-bis(2-methoxyethyl)-2-(methylaminomethyl)aniline (PubChem CID 61418447) has the molecular formula C14H23ClN2O2 and a molecular weight of 286.80 g/mol. Its IUPAC name is 3-chloro-N,N-bis(2-methoxyethyl)-2-(methylaminomethyl)aniline.
| Compound Name | 3-chloro-N,N-bis(2-methoxyethyl)-2-(methylaminomethyl)aniline |
|---|---|
| PubChem CID | 61418447 |
| Molecular Formula | C14H23ClN2O2 |
| Molecular Weight | 286.80 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 3-chloro-N,N-bis(2-methoxyethyl)-2-(methylaminomethyl)aniline |
| SMILES | CNCc1c(Cl)cccc1N(CCOC)CCOC |
| InChI | InChI=1S/C14H23ClN2O2/c1-16-11-12-13(15)5-4-6-14(12)17(7-9-18-2)8-10-19-3/h4-6,16H,7-11H2,1-3H3 |
| InChIKey | WDKZLBQTWFVYTF-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.80 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |