About [1-ethyl-4-(1,4-thiazepan-4-yl)piperidin-4-yl]methanamine
[1-ethyl-4-(1,4-thiazepan-4-yl)piperidin-4-yl]methanamine (PubChem CID 61419010) has the molecular formula C13H27N3S
and a molecular weight of 257.45 g/mol. Its IUPAC name is [1-ethyl-4-(1,4-thiazepan-4-yl)piperidin-4-yl]methanamine.
Molecular Properties
| Compound Name | [1-ethyl-4-(1,4-thiazepan-4-yl)piperidin-4-yl]methanamine |
| PubChem CID | 61419010 |
| Molecular Formula | C13H27N3S |
| Molecular Weight | 257.45 g/mol |
| Exact Mass | 257.19 |
| IUPAC Name | [1-ethyl-4-(1,4-thiazepan-4-yl)piperidin-4-yl]methanamine |
| SMILES | CCN1CCC(CN)(N2CCCSCC2)CC1 |
| InChI | InChI=1S/C13H27N3S/c1-2-15-7-4-13(12-14,5-8-15)16-6-3-10-17-11-9-16/h2-12,14H2,1H3 |
| InChIKey | BDZJFGAXUPIUPK-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.45 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-ethyl-4-(1,4-thiazepan-4-yl)piperidin-4-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-ethyl-4-(1,4-thiazepan-4-yl)piperidin-4-yl]methanamine?
The IUPAC name of [1-ethyl-4-(1,4-thiazepan-4-yl)piperidin-4-yl]methanamine (CID 61419010) is [1-ethyl-4-(1,4-thiazepan-4-yl)piperidin-4-yl]methanamine.
What is the SMILES notation for [1-ethyl-4-(1,4-thiazepan-4-yl)piperidin-4-yl]methanamine?
The canonical SMILES for [1-ethyl-4-(1,4-thiazepan-4-yl)piperidin-4-yl]methanamine is CCN1CCC(CN)(N2CCCSCC2)CC1.
What is the InChIKey of [1-ethyl-4-(1,4-thiazepan-4-yl)piperidin-4-yl]methanamine?
The InChIKey is BDZJFGAXUPIUPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27N3S/c1-2-15-7-4-13(12-14,5-8-15)16-6-3-10-17-11-9-16/h2-12,14H2,1H3.
What are the key properties of [1-ethyl-4-(1,4-thiazepan-4-yl)piperidin-4-yl]methanamine?
[1-ethyl-4-(1,4-thiazepan-4-yl)piperidin-4-yl]methanamine has a molecular weight of 257.45 g/mol, XLogP of 1.24, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-ethyl-4-(1,4-thiazepan-4-yl)piperidin-4-yl]methanamine is sourced from PubChem (CID 61419010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).