About 5-(1,4-thiazepan-4-yl)-1,3-benzothiazol-4-amine
5-(1,4-thiazepan-4-yl)-1,3-benzothiazol-4-amine (PubChem CID 61419018) has the molecular formula C12H15N3S2
and a molecular weight of 265.41 g/mol. Its IUPAC name is 5-(1,4-thiazepan-4-yl)-1,3-benzothiazol-4-amine.
Molecular Properties
| Compound Name | 5-(1,4-thiazepan-4-yl)-1,3-benzothiazol-4-amine |
| PubChem CID | 61419018 |
| Molecular Formula | C12H15N3S2 |
| Molecular Weight | 265.41 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | 5-(1,4-thiazepan-4-yl)-1,3-benzothiazol-4-amine |
| SMILES | Nc1c(N2CCCSCC2)ccc2scnc12 |
| InChI | InChI=1S/C12H15N3S2/c13-11-9(15-4-1-6-16-7-5-15)2-3-10-12(11)14-8-17-10/h2-3,8H,1,4-7,13H2 |
| InChIKey | COHUZGVHXRICTG-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.41 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-(1,4-thiazepan-4-yl)-1,3-benzothiazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,4-thiazepan-4-yl)-1,3-benzothiazol-4-amine?
The IUPAC name of 5-(1,4-thiazepan-4-yl)-1,3-benzothiazol-4-amine (CID 61419018) is 5-(1,4-thiazepan-4-yl)-1,3-benzothiazol-4-amine.
What is the SMILES notation for 5-(1,4-thiazepan-4-yl)-1,3-benzothiazol-4-amine?
The canonical SMILES for 5-(1,4-thiazepan-4-yl)-1,3-benzothiazol-4-amine is Nc1c(N2CCCSCC2)ccc2scnc12.
What is the InChIKey of 5-(1,4-thiazepan-4-yl)-1,3-benzothiazol-4-amine?
The InChIKey is COHUZGVHXRICTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3S2/c13-11-9(15-4-1-6-16-7-5-15)2-3-10-12(11)14-8-17-10/h2-3,8H,1,4-7,13H2.
What are the key properties of 5-(1,4-thiazepan-4-yl)-1,3-benzothiazol-4-amine?
5-(1,4-thiazepan-4-yl)-1,3-benzothiazol-4-amine has a molecular weight of 265.41 g/mol, XLogP of 2.82, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,4-thiazepan-4-yl)-1,3-benzothiazol-4-amine is sourced from PubChem (CID 61419018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).