About 3-amino-5-(1,4-thiazepan-4-yl)benzenesulfonamide
3-amino-5-(1,4-thiazepan-4-yl)benzenesulfonamide (PubChem CID 61419235) has the molecular formula C11H17N3O2S2
and a molecular weight of 287.41 g/mol. Its IUPAC name is 3-amino-5-(1,4-thiazepan-4-yl)benzenesulfonamide.
Molecular Properties
| Compound Name | 3-amino-5-(1,4-thiazepan-4-yl)benzenesulfonamide |
| PubChem CID | 61419235 |
| Molecular Formula | C11H17N3O2S2 |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 3-amino-5-(1,4-thiazepan-4-yl)benzenesulfonamide |
| SMILES | Nc1cc(N2CCCSCC2)cc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C11H17N3O2S2/c12-9-6-10(8-11(7-9)18(13,15)16)14-2-1-4-17-5-3-14/h6-8H,1-5,12H2,(H2,13,15,16) |
| InChIKey | VKESSARABOBDGU-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-5-(1,4-thiazepan-4-yl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-5-(1,4-thiazepan-4-yl)benzenesulfonamide?
The IUPAC name of 3-amino-5-(1,4-thiazepan-4-yl)benzenesulfonamide (CID 61419235) is 3-amino-5-(1,4-thiazepan-4-yl)benzenesulfonamide.
What is the SMILES notation for 3-amino-5-(1,4-thiazepan-4-yl)benzenesulfonamide?
The canonical SMILES for 3-amino-5-(1,4-thiazepan-4-yl)benzenesulfonamide is Nc1cc(N2CCCSCC2)cc(S(N)(=O)=O)c1.
What is the InChIKey of 3-amino-5-(1,4-thiazepan-4-yl)benzenesulfonamide?
The InChIKey is VKESSARABOBDGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3O2S2/c12-9-6-10(8-11(7-9)18(13,15)16)14-2-1-4-17-5-3-14/h6-8H,1-5,12H2,(H2,13,15,16).
What are the key properties of 3-amino-5-(1,4-thiazepan-4-yl)benzenesulfonamide?
3-amino-5-(1,4-thiazepan-4-yl)benzenesulfonamide has a molecular weight of 287.41 g/mol, XLogP of 0.86, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-5-(1,4-thiazepan-4-yl)benzenesulfonamide is sourced from PubChem (CID 61419235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).