C15H24N2S — CID 61419346
N-ethyl-1-[2-(1,4-thiazepan-4-yl)phenyl]ethanamine (PubChem CID 61419346) has the molecular formula C15H24N2S and a molecular weight of 264.44 g/mol. Its IUPAC name is N-ethyl-1-[2-(1,4-thiazepan-4-yl)phenyl]ethanamine.
| Compound Name | N-ethyl-1-[2-(1,4-thiazepan-4-yl)phenyl]ethanamine |
|---|---|
| PubChem CID | 61419346 |
| Molecular Formula | C15H24N2S |
| Molecular Weight | 264.44 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | N-ethyl-1-[2-(1,4-thiazepan-4-yl)phenyl]ethanamine |
| SMILES | CCNC(C)c1ccccc1N1CCCSCC1 |
| InChI | InChI=1S/C15H24N2S/c1-3-16-13(2)14-7-4-5-8-15(14)17-9-6-11-18-12-10-17/h4-5,7-8,13,16H,3,6,9-12H2,1-2H3 |
| InChIKey | ZRSPAUMMFIXGHG-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.44 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |