C15H24N2S — CID 61419465
N-[[4-(1,4-thiazepan-4-yl)phenyl]methyl]propan-1-amine (PubChem CID 61419465) has the molecular formula C15H24N2S and a molecular weight of 264.44 g/mol. Its IUPAC name is N-[[4-(1,4-thiazepan-4-yl)phenyl]methyl]propan-1-amine.
| Compound Name | N-[[4-(1,4-thiazepan-4-yl)phenyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 61419465 |
| Molecular Formula | C15H24N2S |
| Molecular Weight | 264.44 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | N-[[4-(1,4-thiazepan-4-yl)phenyl]methyl]propan-1-amine |
| SMILES | CCCNCc1ccc(N2CCCSCC2)cc1 |
| InChI | InChI=1S/C15H24N2S/c1-2-8-16-13-14-4-6-15(7-5-14)17-9-3-11-18-12-10-17/h4-7,16H,2-3,8-13H2,1H3 |
| InChIKey | AUBSAPBIHGFXNB-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.44 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|