About 1-[4-(1,4-thiazepan-4-yl)phenyl]ethanol
1-[4-(1,4-thiazepan-4-yl)phenyl]ethanol (PubChem CID 61419671) has the molecular formula C13H19NOS
and a molecular weight of 237.37 g/mol. Its IUPAC name is 1-[4-(1,4-thiazepan-4-yl)phenyl]ethanol.
Molecular Properties
| Compound Name | 1-[4-(1,4-thiazepan-4-yl)phenyl]ethanol |
| PubChem CID | 61419671 |
| Molecular Formula | C13H19NOS |
| Molecular Weight | 237.37 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 1-[4-(1,4-thiazepan-4-yl)phenyl]ethanol |
| SMILES | CC(O)c1ccc(N2CCCSCC2)cc1 |
| InChI | InChI=1S/C13H19NOS/c1-11(15)12-3-5-13(6-4-12)14-7-2-9-16-10-8-14/h3-6,11,15H,2,7-10H2,1H3 |
| InChIKey | QHYDJJRKJOXUND-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.37 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(1,4-thiazepan-4-yl)phenyl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(1,4-thiazepan-4-yl)phenyl]ethanol?
The IUPAC name of 1-[4-(1,4-thiazepan-4-yl)phenyl]ethanol (CID 61419671) is 1-[4-(1,4-thiazepan-4-yl)phenyl]ethanol.
What is the SMILES notation for 1-[4-(1,4-thiazepan-4-yl)phenyl]ethanol?
The canonical SMILES for 1-[4-(1,4-thiazepan-4-yl)phenyl]ethanol is CC(O)c1ccc(N2CCCSCC2)cc1.
What is the InChIKey of 1-[4-(1,4-thiazepan-4-yl)phenyl]ethanol?
The InChIKey is QHYDJJRKJOXUND-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NOS/c1-11(15)12-3-5-13(6-4-12)14-7-2-9-16-10-8-14/h3-6,11,15H,2,7-10H2,1H3.
What are the key properties of 1-[4-(1,4-thiazepan-4-yl)phenyl]ethanol?
1-[4-(1,4-thiazepan-4-yl)phenyl]ethanol has a molecular weight of 237.37 g/mol, XLogP of 2.68, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(1,4-thiazepan-4-yl)phenyl]ethanol is sourced from PubChem (CID 61419671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).