C16H21N3OS — CID 61419822
N-(4-cyanophenyl)-4-(1,4-thiazepan-4-yl)butanamide (PubChem CID 61419822) has the molecular formula C16H21N3OS and a molecular weight of 303.43 g/mol. Its IUPAC name is N-(4-cyanophenyl)-4-(1,4-thiazepan-4-yl)butanamide.
| Compound Name | N-(4-cyanophenyl)-4-(1,4-thiazepan-4-yl)butanamide |
|---|---|
| PubChem CID | 61419822 |
| Molecular Formula | C16H21N3OS |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | N-(4-cyanophenyl)-4-(1,4-thiazepan-4-yl)butanamide |
| SMILES | N#Cc1ccc(NC(=O)CCCN2CCCSCC2)cc1 |
| InChI | InChI=1S/C16H21N3OS/c17-13-14-4-6-15(7-5-14)18-16(20)3-1-8-19-9-2-11-21-12-10-19/h4-7H,1-3,8-12H2,(H,18,20) |
| InChIKey | PZVXDWBRVYRBMJ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |