About 2-methyl-3-(1,4-thiazepan-4-yl)propanenitrile
2-methyl-3-(1,4-thiazepan-4-yl)propanenitrile (PubChem CID 61419823) has the molecular formula C9H16N2S
and a molecular weight of 184.31 g/mol. Its IUPAC name is 2-methyl-3-(1,4-thiazepan-4-yl)propanenitrile.
Molecular Properties
| Compound Name | 2-methyl-3-(1,4-thiazepan-4-yl)propanenitrile |
| PubChem CID | 61419823 |
| Molecular Formula | C9H16N2S |
| Molecular Weight | 184.31 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | 2-methyl-3-(1,4-thiazepan-4-yl)propanenitrile |
| SMILES | CC(C#N)CN1CCCSCC1 |
| InChI | InChI=1S/C9H16N2S/c1-9(7-10)8-11-3-2-5-12-6-4-11/h9H,2-6,8H2,1H3 |
| InChIKey | SGIKOBSDMGYSTR-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.31 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-3-(1,4-thiazepan-4-yl)propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3-(1,4-thiazepan-4-yl)propanenitrile?
The IUPAC name of 2-methyl-3-(1,4-thiazepan-4-yl)propanenitrile (CID 61419823) is 2-methyl-3-(1,4-thiazepan-4-yl)propanenitrile.
What is the SMILES notation for 2-methyl-3-(1,4-thiazepan-4-yl)propanenitrile?
The canonical SMILES for 2-methyl-3-(1,4-thiazepan-4-yl)propanenitrile is CC(C#N)CN1CCCSCC1.
What is the InChIKey of 2-methyl-3-(1,4-thiazepan-4-yl)propanenitrile?
The InChIKey is SGIKOBSDMGYSTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2S/c1-9(7-10)8-11-3-2-5-12-6-4-11/h9H,2-6,8H2,1H3.
What are the key properties of 2-methyl-3-(1,4-thiazepan-4-yl)propanenitrile?
2-methyl-3-(1,4-thiazepan-4-yl)propanenitrile has a molecular weight of 184.31 g/mol, XLogP of 1.58, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3-(1,4-thiazepan-4-yl)propanenitrile is sourced from PubChem (CID 61419823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).