C15H24N2OS — CID 61419864
2-(3-ethoxyphenyl)-2-(1,4-thiazepan-4-yl)ethanamine (PubChem CID 61419864) has the molecular formula C15H24N2OS and a molecular weight of 280.44 g/mol. Its IUPAC name is 2-(3-ethoxyphenyl)-2-(1,4-thiazepan-4-yl)ethanamine.
| Compound Name | 2-(3-ethoxyphenyl)-2-(1,4-thiazepan-4-yl)ethanamine |
|---|---|
| PubChem CID | 61419864 |
| Molecular Formula | C15H24N2OS |
| Molecular Weight | 280.44 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 2-(3-ethoxyphenyl)-2-(1,4-thiazepan-4-yl)ethanamine |
| SMILES | CCOc1cccc(C(CN)N2CCCSCC2)c1 |
| InChI | InChI=1S/C15H24N2OS/c1-2-18-14-6-3-5-13(11-14)15(12-16)17-7-4-9-19-10-8-17/h3,5-6,11,15H,2,4,7-10,12,16H2,1H3 |
| InChIKey | PTRSMPPGMQOSJW-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.44 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |