C12H16N2O5 — CID 61422268
1-[furan-3-ylmethyl(methyl)carbamoyl]-4-hydroxypyrrolidine-2-carboxylic acid (PubChem CID 61422268) has the molecular formula C12H16N2O5 and a molecular weight of 268.27 g/mol. Its IUPAC name is 1-[furan-3-ylmethyl(methyl)carbamoyl]-4-hydroxypyrrolidine-2-carboxylic acid.
| Compound Name | 1-[furan-3-ylmethyl(methyl)carbamoyl]-4-hydroxypyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 61422268 |
| Molecular Formula | C12H16N2O5 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 1-[furan-3-ylmethyl(methyl)carbamoyl]-4-hydroxypyrrolidine-2-carboxylic acid |
| SMILES | CN(Cc1ccoc1)C(=O)N1CC(O)CC1C(=O)O |
| InChI | InChI=1S/C12H16N2O5/c1-13(5-8-2-3-19-7-8)12(18)14-6-9(15)4-10(14)11(16)17/h2-3,7,9-10,15H,4-6H2,1H3,(H,16,17) |
| InChIKey | ANWVPEVWINCRTO-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |