phenazine-2-carboxylic acid

C13H8N2O2 — CID 614224

IUPACphenazine-2-carboxylic acid
SMILESO=C(O)c1ccc2nc3ccccc3nc2c1
InChIInChI=1S/C13H8N2O2/c16-13(17)8-5-6-11-12(7-8)15-10-4-2-1-3-9(10)14-11/h1-7H,(H,16,17)
InChIKeyLFDLISNVRKBBAW-UHFFFAOYSA-N
MW224.22 g/mol
LogP2.48
Rot. Bonds1

About phenazine-2-carboxylic acid

phenazine-2-carboxylic acid (PubChem CID 614224) has the molecular formula C13H8N2O2 and a molecular weight of 224.22 g/mol. Its IUPAC name is phenazine-2-carboxylic acid.

Molecular Properties

Compound Namephenazine-2-carboxylic acid
PubChem CID614224
Molecular FormulaC13H8N2O2
Molecular Weight224.22 g/mol
Exact Mass224.06
IUPAC Namephenazine-2-carboxylic acid
SMILESO=C(O)c1ccc2nc3ccccc3nc2c1
InChIInChI=1S/C13H8N2O2/c16-13(17)8-5-6-11-12(7-8)15-10-4-2-1-3-9(10)14-11/h1-7H,(H,16,17)
InChIKeyLFDLISNVRKBBAW-UHFFFAOYSA-N
XLogP2.48
TPSA63.08 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500224.22
LogP ≤ 52.48
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}

Analyze phenazine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of phenazine-2-carboxylic acid?
The IUPAC name of phenazine-2-carboxylic acid (CID 614224) is phenazine-2-carboxylic acid.
What is the SMILES notation for phenazine-2-carboxylic acid?
The canonical SMILES for phenazine-2-carboxylic acid is O=C(O)c1ccc2nc3ccccc3nc2c1.
What is the InChIKey of phenazine-2-carboxylic acid?
The InChIKey is LFDLISNVRKBBAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8N2O2/c16-13(17)8-5-6-11-12(7-8)15-10-4-2-1-3-9(10)14-11/h1-7H,(H,16,17).
What are the key properties of phenazine-2-carboxylic acid?
phenazine-2-carboxylic acid has a molecular weight of 224.22 g/mol, XLogP of 2.48, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phenazine-2-carboxylic acid is sourced from PubChem (CID 614224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).