About 6-chloro-N-(furan-3-ylmethyl)-N-methylimidazo[2,1-b][1,3]thiazole-5-sulfonamide
6-chloro-N-(furan-3-ylmethyl)-N-methylimidazo[2,1-b][1,3]thiazole-5-sulfonamide (PubChem CID 61422810) has the molecular formula C11H10ClN3O3S2
and a molecular weight of 331.81 g/mol. Its IUPAC name is 6-chloro-N-(furan-3-ylmethyl)-N-methylimidazo[2,1-b][1,3]thiazole-5-sulfonamide.
Molecular Properties
| Compound Name | 6-chloro-N-(furan-3-ylmethyl)-N-methylimidazo[2,1-b][1,3]thiazole-5-sulfonamide |
| PubChem CID | 61422810 |
| Molecular Formula | C11H10ClN3O3S2 |
| Molecular Weight | 331.81 g/mol |
| Exact Mass | 330.99 |
| IUPAC Name | 6-chloro-N-(furan-3-ylmethyl)-N-methylimidazo[2,1-b][1,3]thiazole-5-sulfonamide |
| SMILES | CN(Cc1ccoc1)S(=O)(=O)c1c(Cl)nc2sccn12 |
| InChI | InChI=1S/C11H10ClN3O3S2/c1-14(6-8-2-4-18-7-8)20(16,17)10-9(12)13-11-15(10)3-5-19-11/h2-5,7H,6H2,1H3 |
| InChIKey | SUWKGEUARKLUHT-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 67.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.81 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-chloro-N-(furan-3-ylmethyl)-N-methylimidazo[2,1-b][1,3]thiazole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-N-(furan-3-ylmethyl)-N-methylimidazo[2,1-b][1,3]thiazole-5-sulfonamide?
The IUPAC name of 6-chloro-N-(furan-3-ylmethyl)-N-methylimidazo[2,1-b][1,3]thiazole-5-sulfonamide (CID 61422810) is 6-chloro-N-(furan-3-ylmethyl)-N-methylimidazo[2,1-b][1,3]thiazole-5-sulfonamide.
What is the SMILES notation for 6-chloro-N-(furan-3-ylmethyl)-N-methylimidazo[2,1-b][1,3]thiazole-5-sulfonamide?
The canonical SMILES for 6-chloro-N-(furan-3-ylmethyl)-N-methylimidazo[2,1-b][1,3]thiazole-5-sulfonamide is CN(Cc1ccoc1)S(=O)(=O)c1c(Cl)nc2sccn12.
What is the InChIKey of 6-chloro-N-(furan-3-ylmethyl)-N-methylimidazo[2,1-b][1,3]thiazole-5-sulfonamide?
The InChIKey is SUWKGEUARKLUHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10ClN3O3S2/c1-14(6-8-2-4-18-7-8)20(16,17)10-9(12)13-11-15(10)3-5-19-11/h2-5,7H,6H2,1H3.
What are the key properties of 6-chloro-N-(furan-3-ylmethyl)-N-methylimidazo[2,1-b][1,3]thiazole-5-sulfonamide?
6-chloro-N-(furan-3-ylmethyl)-N-methylimidazo[2,1-b][1,3]thiazole-5-sulfonamide has a molecular weight of 331.81 g/mol, XLogP of 2.46, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-N-(furan-3-ylmethyl)-N-methylimidazo[2,1-b][1,3]thiazole-5-sulfonamide is sourced from PubChem (CID 61422810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).