C16H19N3O2 — CID 61423702
6-amino-7-[ethyl(furan-2-ylmethyl)amino]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 61423702) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is 6-amino-7-[ethyl(furan-2-ylmethyl)amino]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-amino-7-[ethyl(furan-2-ylmethyl)amino]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 61423702 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 6-amino-7-[ethyl(furan-2-ylmethyl)amino]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | CCN(Cc1ccco1)c1cc2c(cc1N)CCC(=O)N2 |
| InChI | InChI=1S/C16H19N3O2/c1-2-19(10-12-4-3-7-21-12)15-9-14-11(8-13(15)17)5-6-16(20)18-14/h3-4,7-9H,2,5-6,10,17H2,1H3,(H,18,20) |
| InChIKey | XMYFYKURTKTQET-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 71.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|