C16H22FNO3 — CID 61424395
1-[3-[(5-ethyl-2-methylmorpholin-4-yl)methyl]-5-fluoro-2-hydroxyphenyl]ethanone (PubChem CID 61424395) has the molecular formula C16H22FNO3 and a molecular weight of 295.35 g/mol. Its IUPAC name is 1-[3-[(5-ethyl-2-methylmorpholin-4-yl)methyl]-5-fluoro-2-hydroxyphenyl]ethanone.
| Compound Name | 1-[3-[(5-ethyl-2-methylmorpholin-4-yl)methyl]-5-fluoro-2-hydroxyphenyl]ethanone |
|---|---|
| PubChem CID | 61424395 |
| Molecular Formula | C16H22FNO3 |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | 1-[3-[(5-ethyl-2-methylmorpholin-4-yl)methyl]-5-fluoro-2-hydroxyphenyl]ethanone |
| SMILES | CCC1COC(C)CN1Cc1cc(F)cc(C(C)=O)c1O |
| InChI | InChI=1S/C16H22FNO3/c1-4-14-9-21-10(2)7-18(14)8-12-5-13(17)6-15(11(3)19)16(12)20/h5-6,10,14,20H,4,7-9H2,1-3H3 |
| InChIKey | BIZSORJUNPTMOU-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|