C15H19NO4 — CID 61424863
3-(5-ethyl-2-methylmorpholine-4-carbonyl)benzoic acid (PubChem CID 61424863) has the molecular formula C15H19NO4 and a molecular weight of 277.32 g/mol. Its IUPAC name is 3-(5-ethyl-2-methylmorpholine-4-carbonyl)benzoic acid.
| Compound Name | 3-(5-ethyl-2-methylmorpholine-4-carbonyl)benzoic acid |
|---|---|
| PubChem CID | 61424863 |
| Molecular Formula | C15H19NO4 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 3-(5-ethyl-2-methylmorpholine-4-carbonyl)benzoic acid |
| SMILES | CCC1COC(C)CN1C(=O)c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C15H19NO4/c1-3-13-9-20-10(2)8-16(13)14(17)11-5-4-6-12(7-11)15(18)19/h4-7,10,13H,3,8-9H2,1-2H3,(H,18,19) |
| InChIKey | JRIOHDTWEFTFSX-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |