C13H12N4 — CID 614255
2,3-dimethyl-6-phenylimidazo[1,2-b][1,2,4]triazine (PubChem CID 614255) has the molecular formula C13H12N4 and a molecular weight of 224.27 g/mol. Its IUPAC name is 2,3-dimethyl-6-phenylimidazo[1,2-b][1,2,4]triazine.
| Compound Name | 2,3-dimethyl-6-phenylimidazo[1,2-b][1,2,4]triazine |
|---|---|
| PubChem CID | 614255 |
| Molecular Formula | C13H12N4 |
| Molecular Weight | 224.27 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | 2,3-dimethyl-6-phenylimidazo[1,2-b][1,2,4]triazine |
| SMILES | Cc1nc2nc(-c3ccccc3)cn2nc1C |
| InChI | InChI=1S/C13H12N4/c1-9-10(2)16-17-8-12(15-13(17)14-9)11-6-4-3-5-7-11/h3-8H,1-2H3 |
| InChIKey | SJKTZSQYBRCPAO-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.27 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |