About 2-ethyl-2-N-(2-methoxyethyl)-2-N,4-dimethylhexane-1,2-diamine
2-ethyl-2-N-(2-methoxyethyl)-2-N,4-dimethylhexane-1,2-diamine (PubChem CID 61427292) has the molecular formula C13H30N2O
and a molecular weight of 230.40 g/mol. Its IUPAC name is 2-ethyl-2-N-(2-methoxyethyl)-2-N,4-dimethylhexane-1,2-diamine.
Molecular Properties
| Compound Name | 2-ethyl-2-N-(2-methoxyethyl)-2-N,4-dimethylhexane-1,2-diamine |
| PubChem CID | 61427292 |
| Molecular Formula | C13H30N2O |
| Molecular Weight | 230.40 g/mol |
| Exact Mass | 230.24 |
| IUPAC Name | 2-ethyl-2-N-(2-methoxyethyl)-2-N,4-dimethylhexane-1,2-diamine |
| SMILES | CCC(C)CC(CC)(CN)N(C)CCOC |
| InChI | InChI=1S/C13H30N2O/c1-6-12(3)10-13(7-2,11-14)15(4)8-9-16-5/h12H,6-11,14H2,1-5H3 |
| InChIKey | AVSAUXHLJQOGRI-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.40 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethyl-2-N-(2-methoxyethyl)-2-N,4-dimethylhexane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-2-N-(2-methoxyethyl)-2-N,4-dimethylhexane-1,2-diamine?
The IUPAC name of 2-ethyl-2-N-(2-methoxyethyl)-2-N,4-dimethylhexane-1,2-diamine (CID 61427292) is 2-ethyl-2-N-(2-methoxyethyl)-2-N,4-dimethylhexane-1,2-diamine.
What is the SMILES notation for 2-ethyl-2-N-(2-methoxyethyl)-2-N,4-dimethylhexane-1,2-diamine?
The canonical SMILES for 2-ethyl-2-N-(2-methoxyethyl)-2-N,4-dimethylhexane-1,2-diamine is CCC(C)CC(CC)(CN)N(C)CCOC.
What is the InChIKey of 2-ethyl-2-N-(2-methoxyethyl)-2-N,4-dimethylhexane-1,2-diamine?
The InChIKey is AVSAUXHLJQOGRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H30N2O/c1-6-12(3)10-13(7-2,11-14)15(4)8-9-16-5/h12H,6-11,14H2,1-5H3.
What are the key properties of 2-ethyl-2-N-(2-methoxyethyl)-2-N,4-dimethylhexane-1,2-diamine?
2-ethyl-2-N-(2-methoxyethyl)-2-N,4-dimethylhexane-1,2-diamine has a molecular weight of 230.40 g/mol, XLogP of 2.11, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-2-N-(2-methoxyethyl)-2-N,4-dimethylhexane-1,2-diamine is sourced from PubChem (CID 61427292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).