About N-[4-[(E)-(1-oxo-3,4-dihydronaphthalen-2-ylidene)methyl]phenyl]acetamide
N-[4-[(E)-(1-oxo-3,4-dihydronaphthalen-2-ylidene)methyl]phenyl]acetamide (PubChem CID 6142841) has the molecular formula C19H17NO2
and a molecular weight of 291.35 g/mol. Its IUPAC name is N-[4-[(E)-(1-oxo-3,4-dihydronaphthalen-2-ylidene)methyl]phenyl]acetamide.
Molecular Properties
| Compound Name | N-[4-[(E)-(1-oxo-3,4-dihydronaphthalen-2-ylidene)methyl]phenyl]acetamide |
| PubChem CID | 6142841 |
| Molecular Formula | C19H17NO2 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | N-[4-[(E)-(1-oxo-3,4-dihydronaphthalen-2-ylidene)methyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(/C=C2\CCc3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C19H17NO2/c1-13(21)20-17-10-6-14(7-11-17)12-16-9-8-15-4-2-3-5-18(15)19(16)22/h2-7,10-12H,8-9H2,1H3,(H,20,21)/b16-12+ |
| InChIKey | RERQTUGPOVUEME-FOWTUZBSSA-N |
| XLogP | 3.86 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-[4-[(E)-(1-oxo-3,4-dihydronaphthalen-2-ylidene)methyl]phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[(E)-(1-oxo-3,4-dihydronaphthalen-2-ylidene)methyl]phenyl]acetamide?
The IUPAC name of N-[4-[(E)-(1-oxo-3,4-dihydronaphthalen-2-ylidene)methyl]phenyl]acetamide (CID 6142841) is N-[4-[(E)-(1-oxo-3,4-dihydronaphthalen-2-ylidene)methyl]phenyl]acetamide.
What is the SMILES notation for N-[4-[(E)-(1-oxo-3,4-dihydronaphthalen-2-ylidene)methyl]phenyl]acetamide?
The canonical SMILES for N-[4-[(E)-(1-oxo-3,4-dihydronaphthalen-2-ylidene)methyl]phenyl]acetamide is CC(=O)Nc1ccc(/C=C2\CCc3ccccc3C2=O)cc1.
What is the InChIKey of N-[4-[(E)-(1-oxo-3,4-dihydronaphthalen-2-ylidene)methyl]phenyl]acetamide?
The InChIKey is RERQTUGPOVUEME-FOWTUZBSSA-N. The full InChI is InChI=1S/C19H17NO2/c1-13(21)20-17-10-6-14(7-11-17)12-16-9-8-15-4-2-3-5-18(15)19(16)22/h2-7,10-12H,8-9H2,1H3,(H,20,21)/b16-12+.
What are the key properties of N-[4-[(E)-(1-oxo-3,4-dihydronaphthalen-2-ylidene)methyl]phenyl]acetamide?
N-[4-[(E)-(1-oxo-3,4-dihydronaphthalen-2-ylidene)methyl]phenyl]acetamide has a molecular weight of 291.35 g/mol, XLogP of 3.86, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[(E)-(1-oxo-3,4-dihydronaphthalen-2-ylidene)methyl]phenyl]acetamide is sourced from PubChem (CID 6142841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).