C13H28N2 — CID 61429136
N,3-dimethyl-N-(2-piperidin-2-ylethyl)butan-1-amine (PubChem CID 61429136) has the molecular formula C13H28N2 and a molecular weight of 212.38 g/mol. Its IUPAC name is N,3-dimethyl-N-(2-piperidin-2-ylethyl)butan-1-amine.
| Compound Name | N,3-dimethyl-N-(2-piperidin-2-ylethyl)butan-1-amine |
|---|---|
| PubChem CID | 61429136 |
| Molecular Formula | C13H28N2 |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.23 |
| IUPAC Name | N,3-dimethyl-N-(2-piperidin-2-ylethyl)butan-1-amine |
| SMILES | CC(C)CCN(C)CCC1CCCCN1 |
| InChI | InChI=1S/C13H28N2/c1-12(2)7-10-15(3)11-8-13-6-4-5-9-14-13/h12-14H,4-11H2,1-3H3 |
| InChIKey | XMPYYKRXYXJZJX-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |