About 5-amino-2-(3,3-dimethylmorpholin-4-yl)pyridine-3-carbonitrile
5-amino-2-(3,3-dimethylmorpholin-4-yl)pyridine-3-carbonitrile (PubChem CID 61429731) has the molecular formula C12H16N4O
and a molecular weight of 232.29 g/mol. Its IUPAC name is 5-amino-2-(3,3-dimethylmorpholin-4-yl)pyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 5-amino-2-(3,3-dimethylmorpholin-4-yl)pyridine-3-carbonitrile |
| PubChem CID | 61429731 |
| Molecular Formula | C12H16N4O |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | 5-amino-2-(3,3-dimethylmorpholin-4-yl)pyridine-3-carbonitrile |
| SMILES | CC1(C)COCCN1c1ncc(N)cc1C#N |
| InChI | InChI=1S/C12H16N4O/c1-12(2)8-17-4-3-16(12)11-9(6-13)5-10(14)7-15-11/h5,7H,3-4,8,14H2,1-2H3 |
| InChIKey | NFFDFGAVAFDRBD-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 75.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-amino-2-(3,3-dimethylmorpholin-4-yl)pyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-2-(3,3-dimethylmorpholin-4-yl)pyridine-3-carbonitrile?
The IUPAC name of 5-amino-2-(3,3-dimethylmorpholin-4-yl)pyridine-3-carbonitrile (CID 61429731) is 5-amino-2-(3,3-dimethylmorpholin-4-yl)pyridine-3-carbonitrile.
What is the SMILES notation for 5-amino-2-(3,3-dimethylmorpholin-4-yl)pyridine-3-carbonitrile?
The canonical SMILES for 5-amino-2-(3,3-dimethylmorpholin-4-yl)pyridine-3-carbonitrile is CC1(C)COCCN1c1ncc(N)cc1C#N.
What is the InChIKey of 5-amino-2-(3,3-dimethylmorpholin-4-yl)pyridine-3-carbonitrile?
The InChIKey is NFFDFGAVAFDRBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N4O/c1-12(2)8-17-4-3-16(12)11-9(6-13)5-10(14)7-15-11/h5,7H,3-4,8,14H2,1-2H3.
What are the key properties of 5-amino-2-(3,3-dimethylmorpholin-4-yl)pyridine-3-carbonitrile?
5-amino-2-(3,3-dimethylmorpholin-4-yl)pyridine-3-carbonitrile has a molecular weight of 232.29 g/mol, XLogP of 1.15, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-2-(3,3-dimethylmorpholin-4-yl)pyridine-3-carbonitrile is sourced from PubChem (CID 61429731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).