About N-(3-aminopropyl)-3-(3,3-dimethylmorpholin-4-yl)-N-methylpropanamide
N-(3-aminopropyl)-3-(3,3-dimethylmorpholin-4-yl)-N-methylpropanamide (PubChem CID 61430198) has the molecular formula C13H27N3O2
and a molecular weight of 257.38 g/mol. Its IUPAC name is N-(3-aminopropyl)-3-(3,3-dimethylmorpholin-4-yl)-N-methylpropanamide.
Molecular Properties
| Compound Name | N-(3-aminopropyl)-3-(3,3-dimethylmorpholin-4-yl)-N-methylpropanamide |
| PubChem CID | 61430198 |
| Molecular Formula | C13H27N3O2 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.21 |
| IUPAC Name | N-(3-aminopropyl)-3-(3,3-dimethylmorpholin-4-yl)-N-methylpropanamide |
| SMILES | CN(CCCN)C(=O)CCN1CCOCC1(C)C |
| InChI | InChI=1S/C13H27N3O2/c1-13(2)11-18-10-9-16(13)8-5-12(17)15(3)7-4-6-14/h4-11,14H2,1-3H3 |
| InChIKey | PCOIHFJTFIFJDA-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(3-aminopropyl)-3-(3,3-dimethylmorpholin-4-yl)-N-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-aminopropyl)-3-(3,3-dimethylmorpholin-4-yl)-N-methylpropanamide?
The IUPAC name of N-(3-aminopropyl)-3-(3,3-dimethylmorpholin-4-yl)-N-methylpropanamide (CID 61430198) is N-(3-aminopropyl)-3-(3,3-dimethylmorpholin-4-yl)-N-methylpropanamide.
What is the SMILES notation for N-(3-aminopropyl)-3-(3,3-dimethylmorpholin-4-yl)-N-methylpropanamide?
The canonical SMILES for N-(3-aminopropyl)-3-(3,3-dimethylmorpholin-4-yl)-N-methylpropanamide is CN(CCCN)C(=O)CCN1CCOCC1(C)C.
What is the InChIKey of N-(3-aminopropyl)-3-(3,3-dimethylmorpholin-4-yl)-N-methylpropanamide?
The InChIKey is PCOIHFJTFIFJDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27N3O2/c1-13(2)11-18-10-9-16(13)8-5-12(17)15(3)7-4-6-14/h4-11,14H2,1-3H3.
What are the key properties of N-(3-aminopropyl)-3-(3,3-dimethylmorpholin-4-yl)-N-methylpropanamide?
N-(3-aminopropyl)-3-(3,3-dimethylmorpholin-4-yl)-N-methylpropanamide has a molecular weight of 257.38 g/mol, XLogP of 0.29, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-aminopropyl)-3-(3,3-dimethylmorpholin-4-yl)-N-methylpropanamide is sourced from PubChem (CID 61430198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).