About 4-(4-bromobutyl)-3,3-dimethylmorpholine
4-(4-bromobutyl)-3,3-dimethylmorpholine (PubChem CID 61430684) has the molecular formula C10H20BrNO
and a molecular weight of 250.18 g/mol. Its IUPAC name is 4-(4-bromobutyl)-3,3-dimethylmorpholine.
Molecular Properties
| Compound Name | 4-(4-bromobutyl)-3,3-dimethylmorpholine |
| PubChem CID | 61430684 |
| Molecular Formula | C10H20BrNO |
| Molecular Weight | 250.18 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | 4-(4-bromobutyl)-3,3-dimethylmorpholine |
| SMILES | CC1(C)COCCN1CCCCBr |
| InChI | InChI=1S/C10H20BrNO/c1-10(2)9-13-8-7-12(10)6-4-3-5-11/h3-9H2,1-2H3 |
| InChIKey | DICWBUXNHVAGDU-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.18 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-bromobutyl)-3,3-dimethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-bromobutyl)-3,3-dimethylmorpholine?
The IUPAC name of 4-(4-bromobutyl)-3,3-dimethylmorpholine (CID 61430684) is 4-(4-bromobutyl)-3,3-dimethylmorpholine.
What is the SMILES notation for 4-(4-bromobutyl)-3,3-dimethylmorpholine?
The canonical SMILES for 4-(4-bromobutyl)-3,3-dimethylmorpholine is CC1(C)COCCN1CCCCBr.
What is the InChIKey of 4-(4-bromobutyl)-3,3-dimethylmorpholine?
The InChIKey is DICWBUXNHVAGDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20BrNO/c1-10(2)9-13-8-7-12(10)6-4-3-5-11/h3-9H2,1-2H3.
What are the key properties of 4-(4-bromobutyl)-3,3-dimethylmorpholine?
4-(4-bromobutyl)-3,3-dimethylmorpholine has a molecular weight of 250.18 g/mol, XLogP of 2.27, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-bromobutyl)-3,3-dimethylmorpholine is sourced from PubChem (CID 61430684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).