C12H20N3O2+ — CID 61432416
N,3-dimethyl-N-(oxan-2-ylmethyl)imidazol-3-ium-1-carboxamide (PubChem CID 61432416) has the molecular formula C12H20N3O2+ and a molecular weight of 238.31 g/mol. Its IUPAC name is N,3-dimethyl-N-(oxan-2-ylmethyl)imidazol-3-ium-1-carboxamide.
| Compound Name | N,3-dimethyl-N-(oxan-2-ylmethyl)imidazol-3-ium-1-carboxamide |
|---|---|
| PubChem CID | 61432416 |
| Molecular Formula | C12H20N3O2+ |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | N,3-dimethyl-N-(oxan-2-ylmethyl)imidazol-3-ium-1-carboxamide |
| SMILES | CN(CC1CCCCO1)C(=O)n1cc[n+](C)c1 |
| InChI | InChI=1S/C12H20N3O2/c1-13-6-7-15(10-13)12(16)14(2)9-11-5-3-4-8-17-11/h6-7,10-11H,3-5,8-9H2,1-2H3/q+1 |
| InChIKey | XEPXOHDASXMEAB-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 38.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|