C12H20N2S2 — CID 61436759
3-(aminomethyl)-N-ethyl-N-(thiophen-2-ylmethyl)thiolan-3-amine (PubChem CID 61436759) has the molecular formula C12H20N2S2 and a molecular weight of 256.44 g/mol. Its IUPAC name is 3-(aminomethyl)-N-ethyl-N-(thiophen-2-ylmethyl)thiolan-3-amine.
| Compound Name | 3-(aminomethyl)-N-ethyl-N-(thiophen-2-ylmethyl)thiolan-3-amine |
|---|---|
| PubChem CID | 61436759 |
| Molecular Formula | C12H20N2S2 |
| Molecular Weight | 256.44 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 3-(aminomethyl)-N-ethyl-N-(thiophen-2-ylmethyl)thiolan-3-amine |
| SMILES | CCN(Cc1cccs1)C1(CN)CCSC1 |
| InChI | InChI=1S/C12H20N2S2/c1-2-14(8-11-4-3-6-16-11)12(9-13)5-7-15-10-12/h3-4,6H,2,5,7-10,13H2,1H3 |
| InChIKey | DYJMSRQBNJVHGW-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.44 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |