C15H19N3S2 — CID 61437514
2-[ethyl(thiophen-2-ylmethyl)amino]-4,6-dimethylpyridine-3-carbothioamide (PubChem CID 61437514) has the molecular formula C15H19N3S2 and a molecular weight of 305.47 g/mol. Its IUPAC name is 2-[ethyl(thiophen-2-ylmethyl)amino]-4,6-dimethylpyridine-3-carbothioamide.
| Compound Name | 2-[ethyl(thiophen-2-ylmethyl)amino]-4,6-dimethylpyridine-3-carbothioamide |
|---|---|
| PubChem CID | 61437514 |
| Molecular Formula | C15H19N3S2 |
| Molecular Weight | 305.47 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | 2-[ethyl(thiophen-2-ylmethyl)amino]-4,6-dimethylpyridine-3-carbothioamide |
| SMILES | CCN(Cc1cccs1)c1nc(C)cc(C)c1C(N)=S |
| InChI | InChI=1S/C15H19N3S2/c1-4-18(9-12-6-5-7-20-12)15-13(14(16)19)10(2)8-11(3)17-15/h5-8H,4,9H2,1-3H3,(H2,16,19) |
| InChIKey | JNQXGHPQEDXMQP-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.47 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|