C15H21FN4O — CID 61440078
N-(2-amino-5-fluorophenyl)-2-(4-cyclopropylpiperazin-1-yl)acetamide (PubChem CID 61440078) has the molecular formula C15H21FN4O and a molecular weight of 292.36 g/mol. Its IUPAC name is N-(2-amino-5-fluorophenyl)-2-(4-cyclopropylpiperazin-1-yl)acetamide.
| Compound Name | N-(2-amino-5-fluorophenyl)-2-(4-cyclopropylpiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 61440078 |
| Molecular Formula | C15H21FN4O |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | N-(2-amino-5-fluorophenyl)-2-(4-cyclopropylpiperazin-1-yl)acetamide |
| SMILES | Nc1ccc(F)cc1NC(=O)CN1CCN(C2CC2)CC1 |
| InChI | InChI=1S/C15H21FN4O/c16-11-1-4-13(17)14(9-11)18-15(21)10-19-5-7-20(8-6-19)12-2-3-12/h1,4,9,12H,2-3,5-8,10,17H2,(H,18,21) |
| InChIKey | VIGKFACFFCUBPB-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|