C15H22N4O2 — CID 61440098
1-N-[4-(aminomethyl)phenyl]-4-N-methylpiperidine-1,4-dicarboxamide (PubChem CID 61440098) has the molecular formula C15H22N4O2 and a molecular weight of 290.37 g/mol. Its IUPAC name is 1-N-[4-(aminomethyl)phenyl]-4-N-methylpiperidine-1,4-dicarboxamide.
| Compound Name | 1-N-[4-(aminomethyl)phenyl]-4-N-methylpiperidine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 61440098 |
| Molecular Formula | C15H22N4O2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 1-N-[4-(aminomethyl)phenyl]-4-N-methylpiperidine-1,4-dicarboxamide |
| SMILES | CNC(=O)C1CCN(C(=O)Nc2ccc(CN)cc2)CC1 |
| InChI | InChI=1S/C15H22N4O2/c1-17-14(20)12-6-8-19(9-7-12)15(21)18-13-4-2-11(10-16)3-5-13/h2-5,12H,6-10,16H2,1H3,(H,17,20)(H,18,21) |
| InChIKey | AWQZSQBYEZUQNR-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |