About N'-butyl-N'-cyclopropyl-2-phenylpropane-1,3-diamine
N'-butyl-N'-cyclopropyl-2-phenylpropane-1,3-diamine (PubChem CID 61440470) has the molecular formula C16H26N2
and a molecular weight of 246.40 g/mol. Its IUPAC name is N'-butyl-N'-cyclopropyl-2-phenylpropane-1,3-diamine.
Molecular Properties
| Compound Name | N'-butyl-N'-cyclopropyl-2-phenylpropane-1,3-diamine |
| PubChem CID | 61440470 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | N'-butyl-N'-cyclopropyl-2-phenylpropane-1,3-diamine |
| SMILES | CCCCN(CC(CN)c1ccccc1)C1CC1 |
| InChI | InChI=1S/C16H26N2/c1-2-3-11-18(16-9-10-16)13-15(12-17)14-7-5-4-6-8-14/h4-8,15-16H,2-3,9-13,17H2,1H3 |
| InChIKey | KNXLKSSMVXRMRO-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N'-butyl-N'-cyclopropyl-2-phenylpropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-butyl-N'-cyclopropyl-2-phenylpropane-1,3-diamine?
The IUPAC name of N'-butyl-N'-cyclopropyl-2-phenylpropane-1,3-diamine (CID 61440470) is N'-butyl-N'-cyclopropyl-2-phenylpropane-1,3-diamine.
What is the SMILES notation for N'-butyl-N'-cyclopropyl-2-phenylpropane-1,3-diamine?
The canonical SMILES for N'-butyl-N'-cyclopropyl-2-phenylpropane-1,3-diamine is CCCCN(CC(CN)c1ccccc1)C1CC1.
What is the InChIKey of N'-butyl-N'-cyclopropyl-2-phenylpropane-1,3-diamine?
The InChIKey is KNXLKSSMVXRMRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N2/c1-2-3-11-18(16-9-10-16)13-15(12-17)14-7-5-4-6-8-14/h4-8,15-16H,2-3,9-13,17H2,1H3.
What are the key properties of N'-butyl-N'-cyclopropyl-2-phenylpropane-1,3-diamine?
N'-butyl-N'-cyclopropyl-2-phenylpropane-1,3-diamine has a molecular weight of 246.40 g/mol, XLogP of 2.99, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-butyl-N'-cyclopropyl-2-phenylpropane-1,3-diamine is sourced from PubChem (CID 61440470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).