C24H26N2O2 — CID 614407
2,4-bis(4-methoxyphenyl)-4-methyl-1,2,3,5-tetrahydro-1,5-benzodiazepine (PubChem CID 614407) has the molecular formula C24H26N2O2 and a molecular weight of 374.48 g/mol. Its IUPAC name is 2,4-bis(4-methoxyphenyl)-4-methyl-1,2,3,5-tetrahydro-1,5-benzodiazepine.
| Compound Name | 2,4-bis(4-methoxyphenyl)-4-methyl-1,2,3,5-tetrahydro-1,5-benzodiazepine |
|---|---|
| PubChem CID | 614407 |
| Molecular Formula | C24H26N2O2 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | 2,4-bis(4-methoxyphenyl)-4-methyl-1,2,3,5-tetrahydro-1,5-benzodiazepine |
| SMILES | COc1ccc(C2CC(C)(c3ccc(OC)cc3)Nc3ccccc3N2)cc1 |
| InChI | InChI=1S/C24H26N2O2/c1-24(18-10-14-20(28-3)15-11-18)16-23(17-8-12-19(27-2)13-9-17)25-21-6-4-5-7-22(21)26-24/h4-15,23,25-26H,16H2,1-3H3 |
| InChIKey | IWKLXNHIGJNDLO-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_alk_C(1)', 'substructure': 'N/A'} |
|---|