C14H17FN2O2 — CID 61441707
4-(4-cyclopropylpiperazin-1-yl)-3-fluorobenzoic acid (PubChem CID 61441707) has the molecular formula C14H17FN2O2 and a molecular weight of 264.30 g/mol. Its IUPAC name is 4-(4-cyclopropylpiperazin-1-yl)-3-fluorobenzoic acid.
| Compound Name | 4-(4-cyclopropylpiperazin-1-yl)-3-fluorobenzoic acid |
|---|---|
| PubChem CID | 61441707 |
| Molecular Formula | C14H17FN2O2 |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 4-(4-cyclopropylpiperazin-1-yl)-3-fluorobenzoic acid |
| SMILES | O=C(O)c1ccc(N2CCN(C3CC3)CC2)c(F)c1 |
| InChI | InChI=1S/C14H17FN2O2/c15-12-9-10(14(18)19)1-4-13(12)17-7-5-16(6-8-17)11-2-3-11/h1,4,9,11H,2-3,5-8H2,(H,18,19) |
| InChIKey | DALPWERKQJFXDU-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |